C32H33BCl2N4O5 — CID 142596432
[(1R)-1-[[(2S)-3-[3-[[(E)-2-cyano-4-methylpent-2-enoyl]-methylamino]phenyl]-2-[(2,5-dichlorobenzoyl)amino]propanoyl]amino]-2-phenylethyl]boronic acid (PubChem CID 142596432) has the molecular formula C32H33BCl2N4O5 and a molecular weight of 635.36 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-3-[3-[[(E)-2-cyano-4-methylpent-2-enoyl]-methylamino]phenyl]-2-[(2,5-dichlorobenzoyl)amino]propanoyl]amino]-2-phenylethyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-3-[3-[[(E)-2-cyano-4-methylpent-2-enoyl]-methylamino]phenyl]-2-[(2,5-dichlorobenzoyl)amino]propanoyl]amino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 142596432 |
| Molecular Formula | C32H33BCl2N4O5 |
| Molecular Weight | 635.36 g/mol |
| Exact Mass | 634.19 |
| IUPAC Name | [(1R)-1-[[(2S)-3-[3-[[(E)-2-cyano-4-methylpent-2-enoyl]-methylamino]phenyl]-2-[(2,5-dichlorobenzoyl)amino]propanoyl]amino]-2-phenylethyl]boronic acid |
| SMILES | CC(C)/C=C(\C#N)C(=O)N(C)c1cccc(C[C@H](NC(=O)c2cc(Cl)ccc2Cl)C(=O)N[C@@H](Cc2ccccc2)B(O)O)c1 |
| InChI | InChI=1S/C32H33BCl2N4O5/c1-20(2)14-23(19-36)32(42)39(3)25-11-7-10-22(15-25)16-28(37-30(40)26-18-24(34)12-13-27(26)35)31(41)38-29(33(43)44)17-21-8-5-4-6-9-21/h4-15,18,20,28-29,43-44H,16-17H2,1-3H3,(H,37,40)(H,38,41)/b23-14+/t28-,29-/m0/s1 |
| InChIKey | BRSONVGRHGTVPJ-KRXMJGKQSA-N |
| XLogP | 4.14 |
| TPSA | 142.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|