C29H46BN5O6 — CID 175051773
[(1R)-1-[[6-[(2-cyano-4-methylpent-2-enoyl)amino]-2-[[(2S,3R)-3-hydroxy-2-(2-methylpropanoylamino)butyl]amino]hexanoyl]amino]-2-phenylethyl]boronic acid (PubChem CID 175051773) has the molecular formula C29H46BN5O6 and a molecular weight of 571.53 g/mol. Its IUPAC name is [(1R)-1-[[6-[(2-cyano-4-methylpent-2-enoyl)amino]-2-[[(2S,3R)-3-hydroxy-2-(2-methylpropanoylamino)butyl]amino]hexanoyl]amino]-2-phenylethyl]boronic acid.
| Compound Name | [(1R)-1-[[6-[(2-cyano-4-methylpent-2-enoyl)amino]-2-[[(2S,3R)-3-hydroxy-2-(2-methylpropanoylamino)butyl]amino]hexanoyl]amino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 175051773 |
| Molecular Formula | C29H46BN5O6 |
| Molecular Weight | 571.53 g/mol |
| Exact Mass | 571.35 |
| IUPAC Name | [(1R)-1-[[6-[(2-cyano-4-methylpent-2-enoyl)amino]-2-[[(2S,3R)-3-hydroxy-2-(2-methylpropanoylamino)butyl]amino]hexanoyl]amino]-2-phenylethyl]boronic acid |
| SMILES | CC(C)C=C(C#N)C(=O)NCCCCC(NC[C@H](NC(=O)C(C)C)[C@@H](C)O)C(=O)N[C@@H](Cc1ccccc1)B(O)O |
| InChI | InChI=1S/C29H46BN5O6/c1-19(2)15-23(17-31)28(38)32-14-10-9-13-24(33-18-25(21(5)36)34-27(37)20(3)4)29(39)35-26(30(40)41)16-22-11-7-6-8-12-22/h6-8,11-12,15,19-21,24-26,33,36,40-41H,9-10,13-14,16,18H2,1-5H3,(H,32,38)(H,34,37)(H,35,39)/t21-,24?,25+,26+/m1/s1 |
| InChIKey | UIIXDLKDLMLJOR-AXAOGCOWSA-N |
| XLogP | 0.60 |
| TPSA | 183.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.53 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|