C14H24BN3O3 — CID 74765795
[(1R)-1-[[(2S)-2,6-diaminohexanoyl]amino]-2-phenylethyl]boronic acid (PubChem CID 74765795) has the molecular formula C14H24BN3O3 and a molecular weight of 293.18 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2,6-diaminohexanoyl]amino]-2-phenylethyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-2,6-diaminohexanoyl]amino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 74765795 |
| Molecular Formula | C14H24BN3O3 |
| Molecular Weight | 293.18 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | [(1R)-1-[[(2S)-2,6-diaminohexanoyl]amino]-2-phenylethyl]boronic acid |
| SMILES | NCCCC[C@H](N)C(=O)N[C@@H](Cc1ccccc1)B(O)O |
| InChI | InChI=1S/C14H24BN3O3/c16-9-5-4-8-12(17)14(19)18-13(15(20)21)10-11-6-2-1-3-7-11/h1-3,6-7,12-13,20-21H,4-5,8-10,16-17H2,(H,18,19)/t12-,13-/m0/s1 |
| InChIKey | PFNBOUOUTLDKRC-STQMWFEESA-N |
| XLogP | -0.82 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.18 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|