C29H38N6O6 — CID 140887960
N-[(2S,3R)-1-[[(2S)-1-(benzylamino)-6-[(2-cyano-4-methylpent-2-enoyl)amino]-1-oxohexan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 140887960) has the molecular formula C29H38N6O6 and a molecular weight of 566.66 g/mol. Its IUPAC name is N-[(2S,3R)-1-[[(2S)-1-(benzylamino)-6-[(2-cyano-4-methylpent-2-enoyl)amino]-1-oxohexan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[(2S,3R)-1-[[(2S)-1-(benzylamino)-6-[(2-cyano-4-methylpent-2-enoyl)amino]-1-oxohexan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 140887960 |
| Molecular Formula | C29H38N6O6 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | N-[(2S,3R)-1-[[(2S)-1-(benzylamino)-6-[(2-cyano-4-methylpent-2-enoyl)amino]-1-oxohexan-2-yl]amino]-3-hydroxy-1-oxobutan-2-yl]-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@H](C(=O)N[C@@H](CCCCNC(=O)C(C#N)=CC(C)C)C(=O)NCc2ccccc2)[C@@H](C)O)no1 |
| InChI | InChI=1S/C29H38N6O6/c1-18(2)14-22(16-30)26(37)31-13-9-8-12-23(27(38)32-17-21-10-6-5-7-11-21)33-29(40)25(20(4)36)34-28(39)24-15-19(3)41-35-24/h5-7,10-11,14-15,18,20,23,25,36H,8-9,12-13,17H2,1-4H3,(H,31,37)(H,32,38)(H,33,40)(H,34,39)/t20-,23+,25+/m1/s1 |
| InChIKey | VKRRDPNOPNYTMY-PBXXJUDPSA-N |
| XLogP | 1.66 |
| TPSA | 186.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|