C25H34BN5O6 — CID 174000664
[C-benzyl-N-[(2S)-6-(2-cyanoprop-2-enoylamino)-2-[[(2S)-2-(2-methylpropanoylamino)propanoyl]amino]hexanoyl]carbonimidoyl]boronic acid (PubChem CID 174000664) has the molecular formula C25H34BN5O6 and a molecular weight of 511.39 g/mol. Its IUPAC name is [C-benzyl-N-[(2S)-6-(2-cyanoprop-2-enoylamino)-2-[[(2S)-2-(2-methylpropanoylamino)propanoyl]amino]hexanoyl]carbonimidoyl]boronic acid.
| Compound Name | [C-benzyl-N-[(2S)-6-(2-cyanoprop-2-enoylamino)-2-[[(2S)-2-(2-methylpropanoylamino)propanoyl]amino]hexanoyl]carbonimidoyl]boronic acid |
|---|---|
| PubChem CID | 174000664 |
| Molecular Formula | C25H34BN5O6 |
| Molecular Weight | 511.39 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | [C-benzyl-N-[(2S)-6-(2-cyanoprop-2-enoylamino)-2-[[(2S)-2-(2-methylpropanoylamino)propanoyl]amino]hexanoyl]carbonimidoyl]boronic acid |
| SMILES | C=C(C#N)C(=O)NCCCC[C@H](NC(=O)[C@H](C)NC(=O)C(C)C)C(=O)/N=C(/Cc1ccccc1)B(O)O |
| InChI | InChI=1S/C25H34BN5O6/c1-16(2)22(32)29-18(4)24(34)30-20(12-8-9-13-28-23(33)17(3)15-27)25(35)31-21(26(36)37)14-19-10-6-5-7-11-19/h5-7,10-11,16,18,20,36-37H,3,8-9,12-14H2,1-2,4H3,(H,28,33)(H,29,32)(H,30,34)/b31-21-/t18-,20-/m0/s1 |
| InChIKey | RMHBDYLPHCKOIU-GLFLUELJSA-N |
| XLogP | 0.22 |
| TPSA | 180.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.39 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|