C29H51N9O4 — CID 58560099
(2S)-6-amino-N-(4-aminobutyl)-2-[[2-[[(2S)-5-(diaminomethylideneamino)-2-[(2-phenylacetyl)amino]pentanoyl]amino]-3-methylbutanoyl]amino]hexanamide (PubChem CID 58560099) has the molecular formula C29H51N9O4 and a molecular weight of 589.79 g/mol. Its IUPAC name is (2S)-6-amino-N-(4-aminobutyl)-2-[[2-[[(2S)-5-(diaminomethylideneamino)-2-[(2-phenylacetyl)amino]pentanoyl]amino]-3-methylbutanoyl]amino]hexanamide.
| Compound Name | (2S)-6-amino-N-(4-aminobutyl)-2-[[2-[[(2S)-5-(diaminomethylideneamino)-2-[(2-phenylacetyl)amino]pentanoyl]amino]-3-methylbutanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 58560099 |
| Molecular Formula | C29H51N9O4 |
| Molecular Weight | 589.79 g/mol |
| Exact Mass | 589.41 |
| IUPAC Name | (2S)-6-amino-N-(4-aminobutyl)-2-[[2-[[(2S)-5-(diaminomethylideneamino)-2-[(2-phenylacetyl)amino]pentanoyl]amino]-3-methylbutanoyl]amino]hexanamide |
| SMILES | CC(C)C(NC(=O)[C@H](CCCN=C(N)N)NC(=O)Cc1ccccc1)C(=O)N[C@@H](CCCCN)C(=O)NCCCCN |
| InChI | InChI=1S/C29H51N9O4/c1-20(2)25(28(42)37-22(13-6-7-15-30)26(40)34-17-9-8-16-31)38-27(41)23(14-10-18-35-29(32)33)36-24(39)19-21-11-4-3-5-12-21/h3-5,11-12,20,22-23,25H,6-10,13-19,30-31H2,1-2H3,(H,34,40)(H,36,39)(H,37,42)(H,38,41)(H4,32,33,35)/t22-,23-,25?/m0/s1 |
| InChIKey | KHLARDUSWLRWKL-REQUTJCGSA-N |
| XLogP | -0.62 |
| TPSA | 232.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.79 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|