C31H47N7O3 — CID 71477955
(2S)-6-amino-N-[4-(diaminomethylideneamino)butyl]-2-[[(2S)-2-[[2-(4-phenylphenyl)acetyl]amino]hexanoyl]amino]hexanamide (PubChem CID 71477955) has the molecular formula C31H47N7O3 and a molecular weight of 565.76 g/mol. Its IUPAC name is (2S)-6-amino-N-[4-(diaminomethylideneamino)butyl]-2-[[(2S)-2-[[2-(4-phenylphenyl)acetyl]amino]hexanoyl]amino]hexanamide.
| Compound Name | (2S)-6-amino-N-[4-(diaminomethylideneamino)butyl]-2-[[(2S)-2-[[2-(4-phenylphenyl)acetyl]amino]hexanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 71477955 |
| Molecular Formula | C31H47N7O3 |
| Molecular Weight | 565.76 g/mol |
| Exact Mass | 565.37 |
| IUPAC Name | (2S)-6-amino-N-[4-(diaminomethylideneamino)butyl]-2-[[(2S)-2-[[2-(4-phenylphenyl)acetyl]amino]hexanoyl]amino]hexanamide |
| SMILES | CCCC[C@H](NC(=O)Cc1ccc(-c2ccccc2)cc1)C(=O)N[C@@H](CCCCN)C(=O)NCCCCN=C(N)N |
| InChI | InChI=1S/C31H47N7O3/c1-2-3-13-27(37-28(39)22-23-15-17-25(18-16-23)24-11-5-4-6-12-24)30(41)38-26(14-7-8-19-32)29(40)35-20-9-10-21-36-31(33)34/h4-6,11-12,15-18,26-27H,2-3,7-10,13-14,19-22,32H2,1H3,(H,35,40)(H,37,39)(H,38,41)(H4,33,34,36)/t26-,27-/m0/s1 |
| InChIKey | LIVXASGRSUCEEY-SVBPBHIXSA-N |
| XLogP | 2.35 |
| TPSA | 177.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.76 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|