C30H44N8O4 — CID 71720082
(2S)-N-[(2S)-6-amino-1-[4-(diaminomethylideneamino)butylamino]-1-oxohexan-2-yl]-2-[[2-oxo-2-(4-phenylphenyl)ethyl]amino]pentanediamide (PubChem CID 71720082) has the molecular formula C30H44N8O4 and a molecular weight of 580.73 g/mol. Its IUPAC name is (2S)-N-[(2S)-6-amino-1-[4-(diaminomethylideneamino)butylamino]-1-oxohexan-2-yl]-2-[[2-oxo-2-(4-phenylphenyl)ethyl]amino]pentanediamide.
| Compound Name | (2S)-N-[(2S)-6-amino-1-[4-(diaminomethylideneamino)butylamino]-1-oxohexan-2-yl]-2-[[2-oxo-2-(4-phenylphenyl)ethyl]amino]pentanediamide |
|---|---|
| PubChem CID | 71720082 |
| Molecular Formula | C30H44N8O4 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.35 |
| IUPAC Name | (2S)-N-[(2S)-6-amino-1-[4-(diaminomethylideneamino)butylamino]-1-oxohexan-2-yl]-2-[[2-oxo-2-(4-phenylphenyl)ethyl]amino]pentanediamide |
| SMILES | NCCCC[C@H](NC(=O)[C@H](CCC(N)=O)NCC(=O)c1ccc(-c2ccccc2)cc1)C(=O)NCCCCN=C(N)N |
| InChI | InChI=1S/C30H44N8O4/c31-17-5-4-10-25(28(41)35-18-6-7-19-36-30(33)34)38-29(42)24(15-16-27(32)40)37-20-26(39)23-13-11-22(12-14-23)21-8-2-1-3-9-21/h1-3,8-9,11-14,24-25,37H,4-7,10,15-20,31H2,(H2,32,40)(H,35,41)(H,38,42)(H4,33,34,36)/t24-,25-/m0/s1 |
| InChIKey | DRRIPKALDCWAJI-DQEYMECFSA-N |
| XLogP | 0.54 |
| TPSA | 220.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|