C28H41N7O3 — CID 71717664
(2S)-6-amino-N-[4-(diaminomethylideneamino)butyl]-2-[[(2S)-2-[[2-oxo-2-(4-phenylphenyl)ethyl]amino]propanoyl]amino]hexanamide (PubChem CID 71717664) has the molecular formula C28H41N7O3 and a molecular weight of 523.68 g/mol. Its IUPAC name is (2S)-6-amino-N-[4-(diaminomethylideneamino)butyl]-2-[[(2S)-2-[[2-oxo-2-(4-phenylphenyl)ethyl]amino]propanoyl]amino]hexanamide.
| Compound Name | (2S)-6-amino-N-[4-(diaminomethylideneamino)butyl]-2-[[(2S)-2-[[2-oxo-2-(4-phenylphenyl)ethyl]amino]propanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 71717664 |
| Molecular Formula | C28H41N7O3 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.33 |
| IUPAC Name | (2S)-6-amino-N-[4-(diaminomethylideneamino)butyl]-2-[[(2S)-2-[[2-oxo-2-(4-phenylphenyl)ethyl]amino]propanoyl]amino]hexanamide |
| SMILES | C[C@H](NCC(=O)c1ccc(-c2ccccc2)cc1)C(=O)N[C@@H](CCCCN)C(=O)NCCCCN=C(N)N |
| InChI | InChI=1S/C28H41N7O3/c1-20(34-19-25(36)23-14-12-22(13-15-23)21-9-3-2-4-10-21)26(37)35-24(11-5-6-16-29)27(38)32-17-7-8-18-33-28(30)31/h2-4,9-10,12-15,20,24,34H,5-8,11,16-19,29H2,1H3,(H,32,38)(H,35,37)(H4,30,31,33)/t20-,24-/m0/s1 |
| InChIKey | JANGEUOQWPBHTC-RDPSFJRHSA-N |
| XLogP | 1.30 |
| TPSA | 177.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|