C28H42N6O2 — CID 175614175
(2R)-5-(diaminomethylideneamino)-2-[[(2R)-2-(methylamino)-3-(4-phenylphenyl)propanoyl]amino]-N-(4-methylpentyl)pentanamide (PubChem CID 175614175) has the molecular formula C28H42N6O2 and a molecular weight of 494.68 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[[(2R)-2-(methylamino)-3-(4-phenylphenyl)propanoyl]amino]-N-(4-methylpentyl)pentanamide.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[[(2R)-2-(methylamino)-3-(4-phenylphenyl)propanoyl]amino]-N-(4-methylpentyl)pentanamide |
|---|---|
| PubChem CID | 175614175 |
| Molecular Formula | C28H42N6O2 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[[(2R)-2-(methylamino)-3-(4-phenylphenyl)propanoyl]amino]-N-(4-methylpentyl)pentanamide |
| SMILES | CN[C@H](Cc1ccc(-c2ccccc2)cc1)C(=O)N[C@H](CCCN=C(N)N)C(=O)NCCCC(C)C |
| InChI | InChI=1S/C28H42N6O2/c1-20(2)9-7-17-32-26(35)24(12-8-18-33-28(29)30)34-27(36)25(31-3)19-21-13-15-23(16-14-21)22-10-5-4-6-11-22/h4-6,10-11,13-16,20,24-25,31H,7-9,12,17-19H2,1-3H3,(H,32,35)(H,34,36)(H4,29,30,33)/t24-,25-/m1/s1 |
| InChIKey | YKOVAEUOXBKOQL-JWQCQUIFSA-N |
| XLogP | 2.57 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|