C25H44N8O4 — CID 71524207
(2S)-6-amino-N-[(2S)-6-amino-1-[4-(diaminomethylideneamino)butylamino]-1-oxohexan-2-yl]-2-[[2-(4-hydroxyphenyl)acetyl]amino]hexanamide (PubChem CID 71524207) has the molecular formula C25H44N8O4 and a molecular weight of 520.68 g/mol. Its IUPAC name is (2S)-6-amino-N-[(2S)-6-amino-1-[4-(diaminomethylideneamino)butylamino]-1-oxohexan-2-yl]-2-[[2-(4-hydroxyphenyl)acetyl]amino]hexanamide.
| Compound Name | (2S)-6-amino-N-[(2S)-6-amino-1-[4-(diaminomethylideneamino)butylamino]-1-oxohexan-2-yl]-2-[[2-(4-hydroxyphenyl)acetyl]amino]hexanamide |
|---|---|
| PubChem CID | 71524207 |
| Molecular Formula | C25H44N8O4 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.35 |
| IUPAC Name | (2S)-6-amino-N-[(2S)-6-amino-1-[4-(diaminomethylideneamino)butylamino]-1-oxohexan-2-yl]-2-[[2-(4-hydroxyphenyl)acetyl]amino]hexanamide |
| SMILES | NCCCC[C@H](NC(=O)Cc1ccc(O)cc1)C(=O)N[C@@H](CCCCN)C(=O)NCCCCN=C(N)N |
| InChI | InChI=1S/C25H44N8O4/c26-13-3-1-7-20(23(36)30-15-5-6-16-31-25(28)29)33-24(37)21(8-2-4-14-27)32-22(35)17-18-9-11-19(34)12-10-18/h9-12,20-21,34H,1-8,13-17,26-27H2,(H,30,36)(H,32,35)(H,33,37)(H4,28,29,31)/t20-,21-/m0/s1 |
| InChIKey | SDWPDFYZGHTRDF-SFTDATJTSA-N |
| XLogP | -0.67 |
| TPSA | 223.97 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|