C26H27BClNO4 — CID 71617581
[(1R)-1-[[(2R)-2-(3-chlorophenyl)-4-oxo-4-phenylbutanoyl]amino]-2-(3-ethylphenyl)ethyl]boronic acid (PubChem CID 71617581) has the molecular formula C26H27BClNO4 and a molecular weight of 463.77 g/mol. Its IUPAC name is [(1R)-1-[[(2R)-2-(3-chlorophenyl)-4-oxo-4-phenylbutanoyl]amino]-2-(3-ethylphenyl)ethyl]boronic acid.
| Compound Name | [(1R)-1-[[(2R)-2-(3-chlorophenyl)-4-oxo-4-phenylbutanoyl]amino]-2-(3-ethylphenyl)ethyl]boronic acid |
|---|---|
| PubChem CID | 71617581 |
| Molecular Formula | C26H27BClNO4 |
| Molecular Weight | 463.77 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | [(1R)-1-[[(2R)-2-(3-chlorophenyl)-4-oxo-4-phenylbutanoyl]amino]-2-(3-ethylphenyl)ethyl]boronic acid |
| SMILES | CCc1cccc(C[C@H](NC(=O)C(CC(=O)c2ccccc2)c2cccc(Cl)c2)B(O)O)c1 |
| InChI | InChI=1S/C26H27BClNO4/c1-2-18-8-6-9-19(14-18)15-25(27(32)33)29-26(31)23(21-12-7-13-22(28)16-21)17-24(30)20-10-4-3-5-11-20/h3-14,16,23,25,32-33H,2,15,17H2,1H3,(H,29,31)/t23?,25-/m0/s1 |
| InChIKey | OEZWCJZOLNMGIL-YNMFNDETSA-N |
| XLogP | 4.00 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.77 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|