C20H24BClN2O4 — CID 123587024
[1-[[3-acetamido-3-(3-chlorophenyl)propanoyl]amino]-2-(3-methylphenyl)ethyl]boronic acid (PubChem CID 123587024) has the molecular formula C20H24BClN2O4 and a molecular weight of 402.69 g/mol. Its IUPAC name is [1-[[3-acetamido-3-(3-chlorophenyl)propanoyl]amino]-2-(3-methylphenyl)ethyl]boronic acid.
| Compound Name | [1-[[3-acetamido-3-(3-chlorophenyl)propanoyl]amino]-2-(3-methylphenyl)ethyl]boronic acid |
|---|---|
| PubChem CID | 123587024 |
| Molecular Formula | C20H24BClN2O4 |
| Molecular Weight | 402.69 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | [1-[[3-acetamido-3-(3-chlorophenyl)propanoyl]amino]-2-(3-methylphenyl)ethyl]boronic acid |
| SMILES | CC(=O)NC(CC(=O)NC(Cc1cccc(C)c1)B(O)O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H24BClN2O4/c1-13-5-3-6-15(9-13)10-19(21(27)28)24-20(26)12-18(23-14(2)25)16-7-4-8-17(22)11-16/h3-9,11,18-19,27-28H,10,12H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | NYSXENVXRPEPTM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.69 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|