C18H22BNO4 — CID 174135595
[(1R)-1-[3-(3-methylphenoxy)propanoylamino]-2-phenylethyl]boronic acid (PubChem CID 174135595) has the molecular formula C18H22BNO4 and a molecular weight of 327.19 g/mol. Its IUPAC name is [(1R)-1-[3-(3-methylphenoxy)propanoylamino]-2-phenylethyl]boronic acid.
| Compound Name | [(1R)-1-[3-(3-methylphenoxy)propanoylamino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 174135595 |
| Molecular Formula | C18H22BNO4 |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | [(1R)-1-[3-(3-methylphenoxy)propanoylamino]-2-phenylethyl]boronic acid |
| SMILES | Cc1cccc(OCCC(=O)N[C@@H](Cc2ccccc2)B(O)O)c1 |
| InChI | InChI=1S/C18H22BNO4/c1-14-6-5-9-16(12-14)24-11-10-18(21)20-17(19(22)23)13-15-7-3-2-4-8-15/h2-9,12,17,22-23H,10-11,13H2,1H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | SGFWWEZCWDMHKA-KRWDZBQOSA-N |
| XLogP | 1.50 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|