C25H26BClN2O4 — CID 75307452
[1-[[3-benzamido-3-(3-chlorophenyl)propanoyl]amino]-2-(4-methylphenyl)ethyl]boronic acid (PubChem CID 75307452) has the molecular formula C25H26BClN2O4 and a molecular weight of 464.76 g/mol. Its IUPAC name is [1-[[3-benzamido-3-(3-chlorophenyl)propanoyl]amino]-2-(4-methylphenyl)ethyl]boronic acid.
| Compound Name | [1-[[3-benzamido-3-(3-chlorophenyl)propanoyl]amino]-2-(4-methylphenyl)ethyl]boronic acid |
|---|---|
| PubChem CID | 75307452 |
| Molecular Formula | C25H26BClN2O4 |
| Molecular Weight | 464.76 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | [1-[[3-benzamido-3-(3-chlorophenyl)propanoyl]amino]-2-(4-methylphenyl)ethyl]boronic acid |
| SMILES | Cc1ccc(CC(NC(=O)CC(NC(=O)c2ccccc2)c2cccc(Cl)c2)B(O)O)cc1 |
| InChI | InChI=1S/C25H26BClN2O4/c1-17-10-12-18(13-11-17)14-23(26(32)33)29-24(30)16-22(20-8-5-9-21(27)15-20)28-25(31)19-6-3-2-4-7-19/h2-13,15,22-23,32-33H,14,16H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | PUHVDVFOHWSYOT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.76 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|