C24H26BN3O5 — CID 75307528
[1-[[3-(3-methoxyphenyl)-3-(pyridine-3-carbonylamino)propanoyl]amino]-2-phenylethyl]boronic acid (PubChem CID 75307528) has the molecular formula C24H26BN3O5 and a molecular weight of 447.30 g/mol. Its IUPAC name is [1-[[3-(3-methoxyphenyl)-3-(pyridine-3-carbonylamino)propanoyl]amino]-2-phenylethyl]boronic acid.
| Compound Name | [1-[[3-(3-methoxyphenyl)-3-(pyridine-3-carbonylamino)propanoyl]amino]-2-phenylethyl]boronic acid |
|---|---|
| PubChem CID | 75307528 |
| Molecular Formula | C24H26BN3O5 |
| Molecular Weight | 447.30 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | [1-[[3-(3-methoxyphenyl)-3-(pyridine-3-carbonylamino)propanoyl]amino]-2-phenylethyl]boronic acid |
| SMILES | COc1cccc(C(CC(=O)NC(Cc2ccccc2)B(O)O)NC(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C24H26BN3O5/c1-33-20-11-5-9-18(14-20)21(27-24(30)19-10-6-12-26-16-19)15-23(29)28-22(25(31)32)13-17-7-3-2-4-8-17/h2-12,14,16,21-22,31-32H,13,15H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | XYYWCQWGQWQING-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|