C24H25BFN3O5 — CID 75306415
[2-(4-fluorophenyl)-1-[[3-(3-methoxyphenyl)-3-(pyridine-3-carbonylamino)propanoyl]amino]ethyl]boronic acid (PubChem CID 75306415) has the molecular formula C24H25BFN3O5 and a molecular weight of 465.29 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1-[[3-(3-methoxyphenyl)-3-(pyridine-3-carbonylamino)propanoyl]amino]ethyl]boronic acid.
| Compound Name | [2-(4-fluorophenyl)-1-[[3-(3-methoxyphenyl)-3-(pyridine-3-carbonylamino)propanoyl]amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 75306415 |
| Molecular Formula | C24H25BFN3O5 |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | [2-(4-fluorophenyl)-1-[[3-(3-methoxyphenyl)-3-(pyridine-3-carbonylamino)propanoyl]amino]ethyl]boronic acid |
| SMILES | COc1cccc(C(CC(=O)NC(Cc2ccc(F)cc2)B(O)O)NC(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C24H25BFN3O5/c1-34-20-6-2-4-17(13-20)21(28-24(31)18-5-3-11-27-15-18)14-23(30)29-22(25(32)33)12-16-7-9-19(26)10-8-16/h2-11,13,15,21-22,32-33H,12,14H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | CPAMGJSAJBFQNB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|