C21H33BN2O7 — CID 53317750
[(1R)-1-[[3-(3-methoxyphenyl)-3-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]amino]propanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 53317750) has the molecular formula C21H33BN2O7 and a molecular weight of 436.31 g/mol. Its IUPAC name is [(1R)-1-[[3-(3-methoxyphenyl)-3-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]amino]propanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[3-(3-methoxyphenyl)-3-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]amino]propanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 53317750 |
| Molecular Formula | C21H33BN2O7 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | [(1R)-1-[[3-(3-methoxyphenyl)-3-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoacetyl]amino]propanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | COc1cccc(C(CC(=O)N[C@@H](CC(C)C)B(O)O)NC(=O)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C21H33BN2O7/c1-13(2)10-17(22(28)29)24-18(25)12-16(14-8-7-9-15(11-14)30-6)23-19(26)20(27)31-21(3,4)5/h7-9,11,13,16-17,28-29H,10,12H2,1-6H3,(H,23,26)(H,24,25)/t16?,17-/m0/s1 |
| InChIKey | FJQZSNCLPLNYJP-DJNXLDHESA-N |
| XLogP | 1.13 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|