C15H23NO4 — CID 70799961
tert-butyl N-[(2S)-1-hydroxy-1-(3-methoxyphenyl)propan-2-yl]carbamate (PubChem CID 70799961) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-hydroxy-1-(3-methoxyphenyl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-hydroxy-1-(3-methoxyphenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 70799961 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | tert-butyl N-[(2S)-1-hydroxy-1-(3-methoxyphenyl)propan-2-yl]carbamate |
| SMILES | COc1cccc(C(O)[C@H](C)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C15H23NO4/c1-10(16-14(18)20-15(2,3)4)13(17)11-7-6-8-12(9-11)19-5/h6-10,13,17H,1-5H3,(H,16,18)/t10-,13?/m0/s1 |
| InChIKey | NSAJJOGMJBVOJY-NKUHCKNESA-N |
| XLogP | 2.64 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |