C17H28N2O3 — CID 103821967
tert-butyl N-[3-[[(1R)-1-(3-methoxyphenyl)ethyl]amino]propyl]carbamate (PubChem CID 103821967) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is tert-butyl N-[3-[[(1R)-1-(3-methoxyphenyl)ethyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[(1R)-1-(3-methoxyphenyl)ethyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 103821967 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | tert-butyl N-[3-[[(1R)-1-(3-methoxyphenyl)ethyl]amino]propyl]carbamate |
| SMILES | COc1cccc([C@@H](C)NCCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H28N2O3/c1-13(14-8-6-9-15(12-14)21-5)18-10-7-11-19-16(20)22-17(2,3)4/h6,8-9,12-13,18H,7,10-11H2,1-5H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | VWVMLGOPMMWCTM-CYBMUJFWSA-N |
| XLogP | 3.26 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|