C18H31N3O2 — CID 103781090
tert-butyl N-[3-[1-[4-(dimethylamino)phenyl]ethylamino]propyl]carbamate (PubChem CID 103781090) has the molecular formula C18H31N3O2 and a molecular weight of 321.47 g/mol. Its IUPAC name is tert-butyl N-[3-[1-[4-(dimethylamino)phenyl]ethylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[1-[4-(dimethylamino)phenyl]ethylamino]propyl]carbamate |
|---|---|
| PubChem CID | 103781090 |
| Molecular Formula | C18H31N3O2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | tert-butyl N-[3-[1-[4-(dimethylamino)phenyl]ethylamino]propyl]carbamate |
| SMILES | CC(NCCCNC(=O)OC(C)(C)C)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C18H31N3O2/c1-14(15-8-10-16(11-9-15)21(5)6)19-12-7-13-20-17(22)23-18(2,3)4/h8-11,14,19H,7,12-13H2,1-6H3,(H,20,22) |
| InChIKey | VTAPINHCGYDRHP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|