C15H24FN3O2 — CID 103894808
tert-butyl N-[3-[1-(5-fluoro-2-pyridinyl)ethylamino]propyl]carbamate (PubChem CID 103894808) has the molecular formula C15H24FN3O2 and a molecular weight of 297.37 g/mol. Its IUPAC name is tert-butyl N-[3-[1-(5-fluoro-2-pyridinyl)ethylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[1-(5-fluoro-2-pyridinyl)ethylamino]propyl]carbamate |
|---|---|
| PubChem CID | 103894808 |
| Molecular Formula | C15H24FN3O2 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | tert-butyl N-[3-[1-(5-fluoro-2-pyridinyl)ethylamino]propyl]carbamate |
| SMILES | CC(NCCCNC(=O)OC(C)(C)C)c1ccc(F)cn1 |
| InChI | InChI=1S/C15H24FN3O2/c1-11(13-7-6-12(16)10-19-13)17-8-5-9-18-14(20)21-15(2,3)4/h6-7,10-11,17H,5,8-9H2,1-4H3,(H,18,20) |
| InChIKey | FIMDBFQQCRPAJL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|