C17H28FN3O2 — CID 103949133
tert-butyl N-[4-[1-(5-fluoro-2-pyridinyl)propylamino]butan-2-yl]carbamate (PubChem CID 103949133) has the molecular formula C17H28FN3O2 and a molecular weight of 325.43 g/mol. Its IUPAC name is tert-butyl N-[4-[1-(5-fluoro-2-pyridinyl)propylamino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[1-(5-fluoro-2-pyridinyl)propylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 103949133 |
| Molecular Formula | C17H28FN3O2 |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | tert-butyl N-[4-[1-(5-fluoro-2-pyridinyl)propylamino]butan-2-yl]carbamate |
| SMILES | CCC(NCCC(C)NC(=O)OC(C)(C)C)c1ccc(F)cn1 |
| InChI | InChI=1S/C17H28FN3O2/c1-6-14(15-8-7-13(18)11-20-15)19-10-9-12(2)21-16(22)23-17(3,4)5/h7-8,11-12,14,19H,6,9-10H2,1-5H3,(H,21,22) |
| InChIKey | FVTUROBSPUCMLQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |