C11H16FN3O2 — CID 112583290
2-[1-(5-fluoro-2-pyridinyl)propylamino]ethyl carbamate (PubChem CID 112583290) has the molecular formula C11H16FN3O2 and a molecular weight of 241.27 g/mol. Its IUPAC name is 2-[1-(5-fluoro-2-pyridinyl)propylamino]ethyl carbamate.
| Compound Name | 2-[1-(5-fluoro-2-pyridinyl)propylamino]ethyl carbamate |
|---|---|
| PubChem CID | 112583290 |
| Molecular Formula | C11H16FN3O2 |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-[1-(5-fluoro-2-pyridinyl)propylamino]ethyl carbamate |
| SMILES | CCC(NCCOC(N)=O)c1ccc(F)cn1 |
| InChI | InChI=1S/C11H16FN3O2/c1-2-9(14-5-6-17-11(13)16)10-4-3-8(12)7-15-10/h3-4,7,9,14H,2,5-6H2,1H3,(H2,13,16) |
| InChIKey | XOAKFVOHERHQRQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|