C12H15FN2 — CID 115975737
N-[1-(5-fluoro-2-pyridinyl)propyl]but-2-yn-1-amine (PubChem CID 115975737) has the molecular formula C12H15FN2 and a molecular weight of 206.26 g/mol. Its IUPAC name is N-[1-(5-fluoro-2-pyridinyl)propyl]but-2-yn-1-amine.
| Compound Name | N-[1-(5-fluoro-2-pyridinyl)propyl]but-2-yn-1-amine |
|---|---|
| PubChem CID | 115975737 |
| Molecular Formula | C12H15FN2 |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | N-[1-(5-fluoro-2-pyridinyl)propyl]but-2-yn-1-amine |
| SMILES | CC#CCNC(CC)c1ccc(F)cn1 |
| InChI | InChI=1S/C12H15FN2/c1-3-5-8-14-11(4-2)12-7-6-10(13)9-15-12/h6-7,9,11,14H,4,8H2,1-2H3 |
| InChIKey | PVEIMGCJIVWSTB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|