C10H16FN3O2S — CID 112582959
2-[1-(5-fluoro-2-pyridinyl)propylamino]ethanesulfonamide (PubChem CID 112582959) has the molecular formula C10H16FN3O2S and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-[1-(5-fluoro-2-pyridinyl)propylamino]ethanesulfonamide.
| Compound Name | 2-[1-(5-fluoro-2-pyridinyl)propylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 112582959 |
| Molecular Formula | C10H16FN3O2S |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-[1-(5-fluoro-2-pyridinyl)propylamino]ethanesulfonamide |
| SMILES | CCC(NCCS(N)(=O)=O)c1ccc(F)cn1 |
| InChI | InChI=1S/C10H16FN3O2S/c1-2-9(13-5-6-17(12,15)16)10-4-3-8(11)7-14-10/h3-4,7,9,13H,2,5-6H2,1H3,(H2,12,15,16) |
| InChIKey | ZQJSGOCKQCYWSV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |