C12H19FN2OS — CID 113356899
1-(5-fluoro-2-pyridinyl)-N-(3-methylsulfinylpropyl)propan-1-amine (PubChem CID 113356899) has the molecular formula C12H19FN2OS and a molecular weight of 258.36 g/mol. Its IUPAC name is 1-(5-fluoro-2-pyridinyl)-N-(3-methylsulfinylpropyl)propan-1-amine.
| Compound Name | 1-(5-fluoro-2-pyridinyl)-N-(3-methylsulfinylpropyl)propan-1-amine |
|---|---|
| PubChem CID | 113356899 |
| Molecular Formula | C12H19FN2OS |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-(5-fluoro-2-pyridinyl)-N-(3-methylsulfinylpropyl)propan-1-amine |
| SMILES | CCC(NCCCS(C)=O)c1ccc(F)cn1 |
| InChI | InChI=1S/C12H19FN2OS/c1-3-11(14-7-4-8-17(2)16)12-6-5-10(13)9-15-12/h5-6,9,11,14H,3-4,7-8H2,1-2H3 |
| InChIKey | AYTGYBOOIVPECX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|