C14H21FN2O2 — CID 103936815
methyl (2S)-2-[1-(5-fluoro-2-pyridinyl)propylamino]-3-methylbutanoate (PubChem CID 103936815) has the molecular formula C14H21FN2O2 and a molecular weight of 268.33 g/mol. Its IUPAC name is methyl (2S)-2-[1-(5-fluoro-2-pyridinyl)propylamino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[1-(5-fluoro-2-pyridinyl)propylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 103936815 |
| Molecular Formula | C14H21FN2O2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | methyl (2S)-2-[1-(5-fluoro-2-pyridinyl)propylamino]-3-methylbutanoate |
| SMILES | CCC(N[C@H](C(=O)OC)C(C)C)c1ccc(F)cn1 |
| InChI | InChI=1S/C14H21FN2O2/c1-5-11(12-7-6-10(15)8-16-12)17-13(9(2)3)14(18)19-4/h6-9,11,13,17H,5H2,1-4H3/t11?,13-/m0/s1 |
| InChIKey | SONAQZRRETUKTJ-YUZLPWPTSA-N |
| XLogP | 2.46 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |