C12H19FN2O — CID 112582914
2-[1-(5-fluoro-2-pyridinyl)propylamino]butan-1-ol (PubChem CID 112582914) has the molecular formula C12H19FN2O and a molecular weight of 226.29 g/mol. Its IUPAC name is 2-[1-(5-fluoro-2-pyridinyl)propylamino]butan-1-ol.
| Compound Name | 2-[1-(5-fluoro-2-pyridinyl)propylamino]butan-1-ol |
|---|---|
| PubChem CID | 112582914 |
| Molecular Formula | C12H19FN2O |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 2-[1-(5-fluoro-2-pyridinyl)propylamino]butan-1-ol |
| SMILES | CCC(CO)NC(CC)c1ccc(F)cn1 |
| InChI | InChI=1S/C12H19FN2O/c1-3-10(8-16)15-11(4-2)12-6-5-9(13)7-14-12/h5-7,10-11,15-16H,3-4,8H2,1-2H3 |
| InChIKey | QAAKOGRXCHWSEW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |