C25H29BN2O4 — CID 102483235
[(1R)-3-methyl-1-[[(2S)-2-(naphthalene-1-carbonylamino)-3-phenylpropanoyl]amino]butyl]boronic acid (PubChem CID 102483235) has the molecular formula C25H29BN2O4 and a molecular weight of 432.33 g/mol. Its IUPAC name is [(1R)-3-methyl-1-[[(2S)-2-(naphthalene-1-carbonylamino)-3-phenylpropanoyl]amino]butyl]boronic acid.
| Compound Name | [(1R)-3-methyl-1-[[(2S)-2-(naphthalene-1-carbonylamino)-3-phenylpropanoyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 102483235 |
| Molecular Formula | C25H29BN2O4 |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | [(1R)-3-methyl-1-[[(2S)-2-(naphthalene-1-carbonylamino)-3-phenylpropanoyl]amino]butyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)c1cccc2ccccc12)B(O)O |
| InChI | InChI=1S/C25H29BN2O4/c1-17(2)15-23(26(31)32)28-25(30)22(16-18-9-4-3-5-10-18)27-24(29)21-14-8-12-19-11-6-7-13-20(19)21/h3-14,17,22-23,31-32H,15-16H2,1-2H3,(H,27,29)(H,28,30)/t22-,23-/m0/s1 |
| InChIKey | GCZTWIZNIQCNSO-GOTSBHOMSA-N |
| XLogP | 2.72 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|