C23H28BN3O5S — CID 24861288
[(1R)-3-methyl-1-[[(2S)-3-phenyl-2-(quinolin-8-ylsulfonylamino)propanoyl]amino]butyl]boronic acid (PubChem CID 24861288) has the molecular formula C23H28BN3O5S and a molecular weight of 469.37 g/mol. Its IUPAC name is [(1R)-3-methyl-1-[[(2S)-3-phenyl-2-(quinolin-8-ylsulfonylamino)propanoyl]amino]butyl]boronic acid.
| Compound Name | [(1R)-3-methyl-1-[[(2S)-3-phenyl-2-(quinolin-8-ylsulfonylamino)propanoyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 24861288 |
| Molecular Formula | C23H28BN3O5S |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | [(1R)-3-methyl-1-[[(2S)-3-phenyl-2-(quinolin-8-ylsulfonylamino)propanoyl]amino]butyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NS(=O)(=O)c1cccc2cccnc12)B(O)O |
| InChI | InChI=1S/C23H28BN3O5S/c1-16(2)14-21(24(29)30)26-23(28)19(15-17-8-4-3-5-9-17)27-33(31,32)20-12-6-10-18-11-7-13-25-22(18)20/h3-13,16,19,21,27,29-30H,14-15H2,1-2H3,(H,26,28)/t19-,21-/m0/s1 |
| InChIKey | XBAHBLRHSVRHIC-FPOVZHCZSA-N |
| XLogP | 1.67 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|