C27H27N3O4S — CID 20950537
N-ethyl-N-(4-methoxyphenyl)-3-phenyl-2-(quinolin-8-ylsulfonylamino)propanamide (PubChem CID 20950537) has the molecular formula C27H27N3O4S and a molecular weight of 489.60 g/mol. Its IUPAC name is N-ethyl-N-(4-methoxyphenyl)-3-phenyl-2-(quinolin-8-ylsulfonylamino)propanamide.
| Compound Name | N-ethyl-N-(4-methoxyphenyl)-3-phenyl-2-(quinolin-8-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 20950537 |
| Molecular Formula | C27H27N3O4S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | N-ethyl-N-(4-methoxyphenyl)-3-phenyl-2-(quinolin-8-ylsulfonylamino)propanamide |
| SMILES | CCN(C(=O)C(Cc1ccccc1)NS(=O)(=O)c1cccc2cccnc12)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H27N3O4S/c1-3-30(22-14-16-23(34-2)17-15-22)27(31)24(19-20-9-5-4-6-10-20)29-35(32,33)25-13-7-11-21-12-8-18-28-26(21)25/h4-18,24,29H,3,19H2,1-2H3 |
| InChIKey | LEHWAOMVYSVVFM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |