C28H28N4O4S — CID 122510074
N-ethyl-2-[(2-methylphenyl)sulfonylcarbamoylamino]-3-phenyl-N-quinolin-6-ylpropanamide (PubChem CID 122510074) has the molecular formula C28H28N4O4S and a molecular weight of 516.62 g/mol. Its IUPAC name is N-ethyl-2-[(2-methylphenyl)sulfonylcarbamoylamino]-3-phenyl-N-quinolin-6-ylpropanamide.
| Compound Name | N-ethyl-2-[(2-methylphenyl)sulfonylcarbamoylamino]-3-phenyl-N-quinolin-6-ylpropanamide |
|---|---|
| PubChem CID | 122510074 |
| Molecular Formula | C28H28N4O4S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | N-ethyl-2-[(2-methylphenyl)sulfonylcarbamoylamino]-3-phenyl-N-quinolin-6-ylpropanamide |
| SMILES | CCN(C(=O)C(Cc1ccccc1)NC(=O)NS(=O)(=O)c1ccccc1C)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C28H28N4O4S/c1-3-32(23-15-16-24-22(19-23)13-9-17-29-24)27(33)25(18-21-11-5-4-6-12-21)30-28(34)31-37(35,36)26-14-8-7-10-20(26)2/h4-17,19,25H,3,18H2,1-2H3,(H2,30,31,34) |
| InChIKey | BCSJIVCKBHBDCO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |