C29H29N3O4S — CID 118037736
N-ethyl-2-[(2-methylphenyl)sulfonylcarbamoylamino]-N-naphthalen-2-yl-3-phenylpropanamide (PubChem CID 118037736) has the molecular formula C29H29N3O4S and a molecular weight of 515.64 g/mol. Its IUPAC name is N-ethyl-2-[(2-methylphenyl)sulfonylcarbamoylamino]-N-naphthalen-2-yl-3-phenylpropanamide.
| Compound Name | N-ethyl-2-[(2-methylphenyl)sulfonylcarbamoylamino]-N-naphthalen-2-yl-3-phenylpropanamide |
|---|---|
| PubChem CID | 118037736 |
| Molecular Formula | C29H29N3O4S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | N-ethyl-2-[(2-methylphenyl)sulfonylcarbamoylamino]-N-naphthalen-2-yl-3-phenylpropanamide |
| SMILES | CCN(C(=O)C(Cc1ccccc1)NC(=O)NS(=O)(=O)c1ccccc1C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H29N3O4S/c1-3-32(25-18-17-23-14-8-9-15-24(23)20-25)28(33)26(19-22-12-5-4-6-13-22)30-29(34)31-37(35,36)27-16-10-7-11-21(27)2/h4-18,20,26H,3,19H2,1-2H3,(H2,30,31,34) |
| InChIKey | MWBBQYHHZIWBHO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |