C25H28N4O5S — CID 118037900
2-[(2-aminophenyl)sulfonylcarbamoylamino]-N-ethyl-N-(4-methoxyphenyl)-3-phenylpropanamide (PubChem CID 118037900) has the molecular formula C25H28N4O5S and a molecular weight of 496.59 g/mol. Its IUPAC name is 2-[(2-aminophenyl)sulfonylcarbamoylamino]-N-ethyl-N-(4-methoxyphenyl)-3-phenylpropanamide.
| Compound Name | 2-[(2-aminophenyl)sulfonylcarbamoylamino]-N-ethyl-N-(4-methoxyphenyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 118037900 |
| Molecular Formula | C25H28N4O5S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 2-[(2-aminophenyl)sulfonylcarbamoylamino]-N-ethyl-N-(4-methoxyphenyl)-3-phenylpropanamide |
| SMILES | CCN(C(=O)C(Cc1ccccc1)NC(=O)NS(=O)(=O)c1ccccc1N)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H28N4O5S/c1-3-29(19-13-15-20(34-2)16-14-19)24(30)22(17-18-9-5-4-6-10-18)27-25(31)28-35(32,33)23-12-8-7-11-21(23)26/h4-16,22H,3,17,26H2,1-2H3,(H2,27,28,31) |
| InChIKey | KYQHFSLREYIVSA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|