C33H44BN3O11S — CID 20627501
[(1R)-1-amino-3-methylbutyl]boronic acid;[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] (2S)-3-naphthalen-1-yl-2-(quinolin-8-ylsulfonylamino)propanoate (PubChem CID 20627501) has the molecular formula C33H44BN3O11S and a molecular weight of 701.60 g/mol. Its IUPAC name is [(1R)-1-amino-3-methylbutyl]boronic acid;[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] (2S)-3-naphthalen-1-yl-2-(quinolin-8-ylsulfonylamino)propanoate.
| Compound Name | [(1R)-1-amino-3-methylbutyl]boronic acid;[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] (2S)-3-naphthalen-1-yl-2-(quinolin-8-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 20627501 |
| Molecular Formula | C33H44BN3O11S |
| Molecular Weight | 701.60 g/mol |
| Exact Mass | 701.28 |
| IUPAC Name | [(1R)-1-amino-3-methylbutyl]boronic acid;[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] (2S)-3-naphthalen-1-yl-2-(quinolin-8-ylsulfonylamino)propanoate |
| SMILES | CC(C)C[C@H](N)B(O)O.O=C(OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)[C@H](Cc1cccc2ccccc12)NS(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C28H30N2O9S.C5H14BNO2/c31-15-22(32)26(34)27(35)23(33)16-39-28(36)21(14-19-9-3-7-17-6-1-2-11-20(17)19)30-40(37,38)24-12-4-8-18-10-5-13-29-25(18)24;1-4(2)3-5(7)6(8)9/h1-13,21-23,26-27,30-35H,14-16H2;4-5,8-9H,3,7H2,1-2H3/t21-,22+,23+,26+,27+;5-/m00/s1 |
| InChIKey | QTGIETDPWCPRHU-NVTNFJFPSA-N |
| XLogP | -0.37 |
| TPSA | 252.99 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.60 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|