C14H24BN3O5S — CID 44583188
[(1R)-1-[[(2S)-2-(methanesulfonamido)-3-pyridin-3-ylpropanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 44583188) has the molecular formula C14H24BN3O5S and a molecular weight of 357.24 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-(methanesulfonamido)-3-pyridin-3-ylpropanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-2-(methanesulfonamido)-3-pyridin-3-ylpropanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 44583188 |
| Molecular Formula | C14H24BN3O5S |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | [(1R)-1-[[(2S)-2-(methanesulfonamido)-3-pyridin-3-ylpropanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1cccnc1)NS(C)(=O)=O)B(O)O |
| InChI | InChI=1S/C14H24BN3O5S/c1-10(2)7-13(15(20)21)17-14(19)12(18-24(3,22)23)8-11-5-4-6-16-9-11/h4-6,9-10,12-13,18,20-21H,7-8H2,1-3H3,(H,17,19)/t12-,13-/m0/s1 |
| InChIKey | OXSPZRIXADOFFD-STQMWFEESA-N |
| XLogP | -0.92 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|