C23H31BN2O4 — CID 3850789
[3-methyl-1-[[3-phenyl-2-(3-phenylpropanoylamino)propanoyl]amino]butyl]boronic acid (PubChem CID 3850789) has the molecular formula C23H31BN2O4 and a molecular weight of 410.32 g/mol. Its IUPAC name is [3-methyl-1-[[3-phenyl-2-(3-phenylpropanoylamino)propanoyl]amino]butyl]boronic acid.
| Compound Name | [3-methyl-1-[[3-phenyl-2-(3-phenylpropanoylamino)propanoyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 3850789 |
| Molecular Formula | C23H31BN2O4 |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | [3-methyl-1-[[3-phenyl-2-(3-phenylpropanoylamino)propanoyl]amino]butyl]boronic acid |
| SMILES | CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)CCc1ccccc1)B(O)O |
| InChI | InChI=1S/C23H31BN2O4/c1-17(2)15-21(24(29)30)26-23(28)20(16-19-11-7-4-8-12-19)25-22(27)14-13-18-9-5-3-6-10-18/h3-12,17,20-21,29-30H,13-16H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | ALDKKIACGNGVQW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|