C26H39BN4O5 — CID 74765724
[(1R)-1-[[(2S)-2-[[(2S)-2-acetamido-3-naphthalen-1-ylpropanoyl]amino]-6-aminohexanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 74765724) has the molecular formula C26H39BN4O5 and a molecular weight of 498.43 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-[[(2S)-2-acetamido-3-naphthalen-1-ylpropanoyl]amino]-6-aminohexanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-2-[[(2S)-2-acetamido-3-naphthalen-1-ylpropanoyl]amino]-6-aminohexanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 74765724 |
| Molecular Formula | C26H39BN4O5 |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | [(1R)-1-[[(2S)-2-[[(2S)-2-acetamido-3-naphthalen-1-ylpropanoyl]amino]-6-aminohexanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(=O)N[C@@H](Cc1cccc2ccccc12)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)B(O)O |
| InChI | InChI=1S/C26H39BN4O5/c1-17(2)15-24(27(35)36)31-25(33)22(13-6-7-14-28)30-26(34)23(29-18(3)32)16-20-11-8-10-19-9-4-5-12-21(19)20/h4-5,8-12,17,22-24,35-36H,6-7,13-16,28H2,1-3H3,(H,29,32)(H,30,34)(H,31,33)/t22-,23-,24-/m0/s1 |
| InChIKey | ZEFQNCKLENVHGI-HJOGWXRNSA-N |
| XLogP | 1.04 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|