C32H39BN4O5S — CID 88908651
[(1R)-3-methyl-1-[[(2S)-2-[[(2S)-1-[2-(naphthalene-1-carbonylamino)acetyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanethioyl]amino]butyl]boronic acid (PubChem CID 88908651) has the molecular formula C32H39BN4O5S and a molecular weight of 602.57 g/mol. Its IUPAC name is [(1R)-3-methyl-1-[[(2S)-2-[[(2S)-1-[2-(naphthalene-1-carbonylamino)acetyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanethioyl]amino]butyl]boronic acid.
| Compound Name | [(1R)-3-methyl-1-[[(2S)-2-[[(2S)-1-[2-(naphthalene-1-carbonylamino)acetyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanethioyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 88908651 |
| Molecular Formula | C32H39BN4O5S |
| Molecular Weight | 602.57 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | [(1R)-3-methyl-1-[[(2S)-2-[[(2S)-1-[2-(naphthalene-1-carbonylamino)acetyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanethioyl]amino]butyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=S)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)c1cccc2ccccc12)B(O)O |
| InChI | InChI=1S/C32H39BN4O5S/c1-21(2)18-28(33(41)42)36-32(43)26(19-22-10-4-3-5-11-22)35-31(40)27-16-9-17-37(27)29(38)20-34-30(39)25-15-8-13-23-12-6-7-14-24(23)25/h3-8,10-15,21,26-28,41-42H,9,16-20H2,1-2H3,(H,34,39)(H,35,40)(H,36,43)/t26-,27-,28-/m0/s1 |
| InChIKey | RYZIESVSVKQMSA-KCHLEUMXSA-N |
| XLogP | 2.63 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.57 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|