C25H30BN3O4 — CID 3723260
[3-methyl-1-[[4-phenyl-2-(quinoline-2-carbonylamino)butanoyl]amino]butyl]boronic acid (PubChem CID 3723260) has the molecular formula C25H30BN3O4 and a molecular weight of 447.34 g/mol. Its IUPAC name is [3-methyl-1-[[4-phenyl-2-(quinoline-2-carbonylamino)butanoyl]amino]butyl]boronic acid.
| Compound Name | [3-methyl-1-[[4-phenyl-2-(quinoline-2-carbonylamino)butanoyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 3723260 |
| Molecular Formula | C25H30BN3O4 |
| Molecular Weight | 447.34 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | [3-methyl-1-[[4-phenyl-2-(quinoline-2-carbonylamino)butanoyl]amino]butyl]boronic acid |
| SMILES | CC(C)CC(NC(=O)C(CCc1ccccc1)NC(=O)c1ccc2ccccc2n1)B(O)O |
| InChI | InChI=1S/C25H30BN3O4/c1-17(2)16-23(26(32)33)29-25(31)22(14-12-18-8-4-3-5-9-18)28-24(30)21-15-13-19-10-6-7-11-20(19)27-21/h3-11,13,15,17,22-23,32-33H,12,14,16H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | VBSHLQHMGVSWJF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|