C25H34BN3O4 — CID 145293984
[(1R)-1-[[(2S)-2-(3,4-dihydro-1H-isoquinoline-2-carbonylamino)-4-phenylbutanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 145293984) has the molecular formula C25H34BN3O4 and a molecular weight of 451.38 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-(3,4-dihydro-1H-isoquinoline-2-carbonylamino)-4-phenylbutanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-2-(3,4-dihydro-1H-isoquinoline-2-carbonylamino)-4-phenylbutanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 145293984 |
| Molecular Formula | C25H34BN3O4 |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | [(1R)-1-[[(2S)-2-(3,4-dihydro-1H-isoquinoline-2-carbonylamino)-4-phenylbutanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCc1ccccc1)NC(=O)N1CCc2ccccc2C1)B(O)O |
| InChI | InChI=1S/C25H34BN3O4/c1-18(2)16-23(26(32)33)28-24(30)22(13-12-19-8-4-3-5-9-19)27-25(31)29-15-14-20-10-6-7-11-21(20)17-29/h3-11,18,22-23,32-33H,12-17H2,1-2H3,(H,27,31)(H,28,30)/t22-,23-/m0/s1 |
| InChIKey | NPCTVOOWDOBFFJ-GOTSBHOMSA-N |
| XLogP | 2.30 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|