C20H30BN3O4 — CID 145293998
[(1R)-1-[[2-(3,4-dihydro-1H-isoquinoline-2-carbonylamino)-3-methylbut-2-enoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 145293998) has the molecular formula C20H30BN3O4 and a molecular weight of 387.29 g/mol. Its IUPAC name is [(1R)-1-[[2-(3,4-dihydro-1H-isoquinoline-2-carbonylamino)-3-methylbut-2-enoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[2-(3,4-dihydro-1H-isoquinoline-2-carbonylamino)-3-methylbut-2-enoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 145293998 |
| Molecular Formula | C20H30BN3O4 |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | [(1R)-1-[[2-(3,4-dihydro-1H-isoquinoline-2-carbonylamino)-3-methylbut-2-enoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)=C(NC(=O)N1CCc2ccccc2C1)C(=O)N[C@@H](CC(C)C)B(O)O |
| InChI | InChI=1S/C20H30BN3O4/c1-13(2)11-17(21(27)28)22-19(25)18(14(3)4)23-20(26)24-10-9-15-7-5-6-8-16(15)12-24/h5-8,13,17,27-28H,9-12H2,1-4H3,(H,22,25)(H,23,26)/t17-/m0/s1 |
| InChIKey | TVYGECJLPXKIFR-KRWDZBQOSA-N |
| XLogP | 1.59 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|