C23H29BCl2N2O6 — CID 127029686
[(1R)-1-[[(2S)-2-[(2,5-dichlorobenzoyl)amino]-3-(3,5-dimethoxyphenyl)propanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 127029686) has the molecular formula C23H29BCl2N2O6 and a molecular weight of 511.21 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-[(2,5-dichlorobenzoyl)amino]-3-(3,5-dimethoxyphenyl)propanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-2-[(2,5-dichlorobenzoyl)amino]-3-(3,5-dimethoxyphenyl)propanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 127029686 |
| Molecular Formula | C23H29BCl2N2O6 |
| Molecular Weight | 511.21 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | [(1R)-1-[[(2S)-2-[(2,5-dichlorobenzoyl)amino]-3-(3,5-dimethoxyphenyl)propanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | COc1cc(C[C@H](NC(=O)c2cc(Cl)ccc2Cl)C(=O)N[C@@H](CC(C)C)B(O)O)cc(OC)c1 |
| InChI | InChI=1S/C23H29BCl2N2O6/c1-13(2)7-21(24(31)32)28-23(30)20(10-14-8-16(33-3)12-17(9-14)34-4)27-22(29)18-11-15(25)5-6-19(18)26/h5-6,8-9,11-13,20-21,31-32H,7,10H2,1-4H3,(H,27,29)(H,28,30)/t20-,21-/m0/s1 |
| InChIKey | AFBKWRDTLXKAPE-SFTDATJTSA-N |
| XLogP | 2.89 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|