C22H33N3O3 — CID 175051907
(2S)-2-acetamido-6-(2-methylpent-2-enoylamino)-N-(2-phenylethyl)hexanamide (PubChem CID 175051907) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is (2S)-2-acetamido-6-(2-methylpent-2-enoylamino)-N-(2-phenylethyl)hexanamide.
| Compound Name | (2S)-2-acetamido-6-(2-methylpent-2-enoylamino)-N-(2-phenylethyl)hexanamide |
|---|---|
| PubChem CID | 175051907 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | (2S)-2-acetamido-6-(2-methylpent-2-enoylamino)-N-(2-phenylethyl)hexanamide |
| SMILES | CCC=C(C)C(=O)NCCCC[C@H](NC(C)=O)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C22H33N3O3/c1-4-10-17(2)21(27)23-15-9-8-13-20(25-18(3)26)22(28)24-16-14-19-11-6-5-7-12-19/h5-7,10-12,20H,4,8-9,13-16H2,1-3H3,(H,23,27)(H,24,28)(H,25,26)/t20-/m0/s1 |
| InChIKey | FOLNZKAPHFQWGX-FQEVSTJZSA-N |
| XLogP | 2.49 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|