C31H42N4O5 — CID 154153864
(2S)-2,6-diacetamido-N-[3-oxo-3-[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino]propyl]hexanamide (PubChem CID 154153864) has the molecular formula C31H42N4O5 and a molecular weight of 550.70 g/mol. Its IUPAC name is (2S)-2,6-diacetamido-N-[3-oxo-3-[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino]propyl]hexanamide.
| Compound Name | (2S)-2,6-diacetamido-N-[3-oxo-3-[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino]propyl]hexanamide |
|---|---|
| PubChem CID | 154153864 |
| Molecular Formula | C31H42N4O5 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | (2S)-2,6-diacetamido-N-[3-oxo-3-[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino]propyl]hexanamide |
| SMILES | CC(=O)NCCCC[C@H](NC(C)=O)C(=O)NCCC(=O)NC(=O)Cc1ccc(CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H42N4O5/c1-23(36)32-20-9-8-14-28(34-24(2)37)31(40)33-21-19-29(38)35-30(39)22-27-17-15-26(16-18-27)13-7-6-12-25-10-4-3-5-11-25/h3-5,10-11,15-18,28H,6-9,12-14,19-22H2,1-2H3,(H,32,36)(H,33,40)(H,34,37)(H,35,38,39)/t28-/m0/s1 |
| InChIKey | ZYXVCQVJHPSONB-NDEPHWFRSA-N |
| XLogP | 2.75 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|