C34H44N4O10 — CID 118235292
[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-[[(2S)-2,5-bis[(2-acetyloxyacetyl)amino]pentanoyl]amino]propanoate (PubChem CID 118235292) has the molecular formula C34H44N4O10 and a molecular weight of 668.74 g/mol. Its IUPAC name is [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-[[(2S)-2,5-bis[(2-acetyloxyacetyl)amino]pentanoyl]amino]propanoate.
| Compound Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-[[(2S)-2,5-bis[(2-acetyloxyacetyl)amino]pentanoyl]amino]propanoate |
|---|---|
| PubChem CID | 118235292 |
| Molecular Formula | C34H44N4O10 |
| Molecular Weight | 668.74 g/mol |
| Exact Mass | 668.31 |
| IUPAC Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-[[(2S)-2,5-bis[(2-acetyloxyacetyl)amino]pentanoyl]amino]propanoate |
| SMILES | CC(=O)OCC(=O)NCCC[C@H](NC(=O)COC(C)=O)C(=O)NCCC(=O)ONC(=O)Cc1ccc(CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H44N4O10/c1-24(39)46-22-31(42)35-19-8-13-29(37-32(43)23-47-25(2)40)34(45)36-20-18-33(44)48-38-30(41)21-28-16-14-27(15-17-28)12-7-6-11-26-9-4-3-5-10-26/h3-5,9-10,14-17,29H,6-8,11-13,18-23H2,1-2H3,(H,35,42)(H,36,45)(H,37,43)(H,38,41)/t29-/m0/s1 |
| InChIKey | KDLZEGUYIIZBHF-LJAQVGFWSA-N |
| XLogP | 1.38 |
| TPSA | 195.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.74 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|