C27H36Cl2N4O4 — CID 129081867
[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-[[(2S)-2,6-bis(chloroamino)hexanoyl]amino]propanoate (PubChem CID 129081867) has the molecular formula C27H36Cl2N4O4 and a molecular weight of 551.52 g/mol. Its IUPAC name is [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-[[(2S)-2,6-bis(chloroamino)hexanoyl]amino]propanoate.
| Compound Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-[[(2S)-2,6-bis(chloroamino)hexanoyl]amino]propanoate |
|---|---|
| PubChem CID | 129081867 |
| Molecular Formula | C27H36Cl2N4O4 |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-[[(2S)-2,6-bis(chloroamino)hexanoyl]amino]propanoate |
| SMILES | O=C(Cc1ccc(CCCCc2ccccc2)cc1)NOC(=O)CCNC(=O)[C@H](CCCCNCl)NCl |
| InChI | InChI=1S/C27H36Cl2N4O4/c28-31-18-7-6-12-24(32-29)27(36)30-19-17-26(35)37-33-25(34)20-23-15-13-22(14-16-23)11-5-4-10-21-8-2-1-3-9-21/h1-3,8-9,13-16,24,31-32H,4-7,10-12,17-20H2,(H,30,36)(H,33,34)/t24-/m0/s1 |
| InChIKey | LUBZKVATQKLGGE-DEOSSOPVSA-N |
| XLogP | 3.90 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|