About [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-(2,4-diaminobutanoylamino)propanoate
[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-(2,4-diaminobutanoylamino)propanoate (PubChem CID 118235146) has the molecular formula C25H34N4O4
and a molecular weight of 454.57 g/mol. Its IUPAC name is [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-(2,4-diaminobutanoylamino)propanoate.
Molecular Properties
| Compound Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-(2,4-diaminobutanoylamino)propanoate |
| PubChem CID | 118235146 |
| Molecular Formula | C25H34N4O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-(2,4-diaminobutanoylamino)propanoate |
| SMILES | NCCC(N)C(=O)NCCC(=O)ONC(=O)Cc1ccc(CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H34N4O4/c26-16-14-22(27)25(32)28-17-15-24(31)33-29-23(30)18-21-12-10-20(11-13-21)9-5-4-8-19-6-2-1-3-7-19/h1-3,6-7,10-13,22H,4-5,8-9,14-18,26-27H2,(H,28,32)(H,29,30) |
| InChIKey | DPNHUCGHBQLWQV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-(2,4-diaminobutanoylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-(2,4-diaminobutanoylamino)propanoate?
The IUPAC name of [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-(2,4-diaminobutanoylamino)propanoate (CID 118235146) is [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-(2,4-diaminobutanoylamino)propanoate.
What is the SMILES notation for [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-(2,4-diaminobutanoylamino)propanoate?
The canonical SMILES for [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-(2,4-diaminobutanoylamino)propanoate is NCCC(N)C(=O)NCCC(=O)ONC(=O)Cc1ccc(CCCCc2ccccc2)cc1.
What is the InChIKey of [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-(2,4-diaminobutanoylamino)propanoate?
The InChIKey is DPNHUCGHBQLWQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H34N4O4/c26-16-14-22(27)25(32)28-17-15-24(31)33-29-23(30)18-21-12-10-20(11-13-21)9-5-4-8-19-6-2-1-3-7-19/h1-3,6-7,10-13,22H,4-5,8-9,14-18,26-27H2,(H,28,32)(H,29,30).
What are the key properties of [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-(2,4-diaminobutanoylamino)propanoate?
[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-(2,4-diaminobutanoylamino)propanoate has a molecular weight of 454.57 g/mol, XLogP of 1.55, 13 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] 3-(2,4-diaminobutanoylamino)propanoate is sourced from PubChem (CID 118235146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).