C33H41N3O4 — CID 118235256
[[2-[3-(4-phenylbutyl)phenyl]acetyl]amino] 6-[[(2S)-2-amino-3-phenylpropanoyl]amino]hexanoate (PubChem CID 118235256) has the molecular formula C33H41N3O4 and a molecular weight of 543.71 g/mol. Its IUPAC name is [[2-[3-(4-phenylbutyl)phenyl]acetyl]amino] 6-[[(2S)-2-amino-3-phenylpropanoyl]amino]hexanoate.
| Compound Name | [[2-[3-(4-phenylbutyl)phenyl]acetyl]amino] 6-[[(2S)-2-amino-3-phenylpropanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 118235256 |
| Molecular Formula | C33H41N3O4 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.31 |
| IUPAC Name | [[2-[3-(4-phenylbutyl)phenyl]acetyl]amino] 6-[[(2S)-2-amino-3-phenylpropanoyl]amino]hexanoate |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)NCCCCCC(=O)ONC(=O)Cc1cccc(CCCCc2ccccc2)c1 |
| InChI | InChI=1S/C33H41N3O4/c34-30(24-28-16-6-2-7-17-28)33(39)35-22-11-3-8-21-32(38)40-36-31(37)25-29-20-12-19-27(23-29)18-10-9-15-26-13-4-1-5-14-26/h1-2,4-7,12-14,16-17,19-20,23,30H,3,8-11,15,18,21-22,24-25,34H2,(H,35,39)(H,36,37)/t30-/m0/s1 |
| InChIKey | FJUGZOZGNUOXGH-PMERELPUSA-N |
| XLogP | 4.62 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|